CAS 1218791-31-1 appears in our catalog under these names: 2-Methoxycarbonyl-3-methylpyridine-5-boronic acid pinacol ester, 96%, Methyl 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)picolinate, 96%, 2-Methoxycarbonyl-3-methylpyridine-5-boronic acid pinacol ester. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg.
Methyl 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate (CAS 1218791-31-1) is a chemical compound with the molecular formula C14H20BNO4 and a molecular weight of 277.13 g/mol. IUPAC name: methyl 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate. InChIKey: SYOVFAXZDVGADR-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO4 |
|---|---|
| Molecular weight | 277.13 g/mol |
| IUPAC name | methyl 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate |
| InChIKey | SYOVFAXZDVGADR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)C(=O)OC)C |
Computed by PubChem (NCBI)