cas: 1588441-10-4 — see every product listed under this CAS number, including other names
(1-Benzylpiperazin-2-yl)methanol hydrochloride, 95%, 95% (CAS 1588441-10-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112QXW-100mg |
| cas | 1588441-10-4 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 467.60 Pln | |
| Chemat | 1g | 1677.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(1-benzylpiperazin-2-yl)methanol;hydrochloride (CAS 1588441-10-4) is a chemical compound with the molecular formula C12H19ClN2O and a molecular weight of 242.74 g/mol. IUPAC name: (1-benzylpiperazin-2-yl)methanol;hydrochloride. InChIKey: OCYNUIPPLSAZDF-UHFFFAOYSA-N.
| Molecular formula | C12H19ClN2O |
|---|---|
| Molecular weight | 242.74 g/mol |
| IUPAC name | (1-benzylpiperazin-2-yl)methanol;hydrochloride |
| InChIKey | OCYNUIPPLSAZDF-UHFFFAOYSA-N |
| SMILES | C1CN(C(CN1)CO)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)