CAS 1185672-87-0 is the registry number for N-(4-Amino-2-methylphenyl)-2,2-dimethylpropanamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-(4-amino-2-methylphenyl)-2,2-dimethylpropanamide;hydrochloride (CAS 1185672-87-0) is a chemical compound with the molecular formula C12H19ClN2O and a molecular weight of 242.74 g/mol. IUPAC name: N-(4-amino-2-methylphenyl)-2,2-dimethylpropanamide;hydrochloride. InChIKey: PKXRMRLLDVAENS-UHFFFAOYSA-N.
| Molecular formula | C12H19ClN2O |
|---|---|
| Molecular weight | 242.74 g/mol |
| IUPAC name | N-(4-amino-2-methylphenyl)-2,2-dimethylpropanamide;hydrochloride |
| InChIKey | PKXRMRLLDVAENS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N)NC(=O)C(C)(C)C.Cl |
Computed by PubChem (NCBI)