CAS 175277-47-1 appears in our catalog under these names: 2-[4-(tert-Butyl)phenoxy]ethanimidamide hydrochloride, 95%, 2-(4-tert-Butylphenoxy)ethanimidamide hydrochloride, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g, 2.5g.
2-(4-tert-butylphenoxy)ethanimidamide;hydrochloride (CAS 175277-47-1) is a chemical compound with the molecular formula C12H19ClN2O and a molecular weight of 242.74 g/mol. IUPAC name: 2-(4-tert-butylphenoxy)ethanimidamide;hydrochloride. InChIKey: UAOWADVOQLCJBN-UHFFFAOYSA-N.
| Molecular formula | C12H19ClN2O |
|---|---|
| Molecular weight | 242.74 g/mol |
| IUPAC name | 2-(4-tert-butylphenoxy)ethanimidamide;hydrochloride |
| InChIKey | UAOWADVOQLCJBN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)OCC(=N)N.Cl |
Computed by PubChem (NCBI)