cas: 210889-31-9 — see every product listed under this CAS number, including other names
(1H-Indol-7-yl)boronic acid, 98%, 98% (CAS 210889-31-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113L2C-100mg |
| cas | 210889-31-9 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 827.60 Pln | |
| Chemat | 250mg | 1341.20 Pln | |
| Chemat | 1g | 2618.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1H-indol-7-ylboronic acid (CAS 210889-31-9) is a chemical compound with the molecular formula C8H8BNO2 and a molecular weight of 160.97 g/mol. IUPAC name: 1H-indol-7-ylboronic acid. InChIKey: HABOMNOJYJNVHE-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO2 |
|---|---|
| Molecular weight | 160.97 g/mol |
| IUPAC name | 1H-indol-7-ylboronic acid |
| InChIKey | HABOMNOJYJNVHE-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)C=CN2)(O)O |
Computed by PubChem (NCBI)