CAS 1451391-42-6 appears in our catalog under these names: 3-Cyano-5-methylphenylboronic acid, 95%, 3–Methyl–5–cyanophenylboronic acid, 3-Cyano-5-methylphenylboronic acid 98%, 3-Methyl-5-cyanophenylboronic acid, 98%, 98%, 3-CYANO-5-METHYLPHENYLBORONIC ACID, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 10mg, 25mg, 100mg.
(3-cyano-5-methylphenyl)boronic acid (CAS 1451391-42-6) is a chemical compound with the molecular formula C8H8BNO2 and a molecular weight of 160.97 g/mol. IUPAC name: (3-cyano-5-methylphenyl)boronic acid. InChIKey: HOWMWRQDWIZJNA-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO2 |
|---|---|
| Molecular weight | 160.97 g/mol |
| IUPAC name | (3-cyano-5-methylphenyl)boronic acid |
| InChIKey | HOWMWRQDWIZJNA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C#N)C)(O)O |
Computed by PubChem (NCBI)