CAS 210889-31-9 appears in our catalog under these names: Indole-7-boronic acid, 98%, (1H-Indol-7-yl)boronic acid, 98%, (1H-Indol-7-yl)boronic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
1H-indol-7-ylboronic acid (CAS 210889-31-9) is a chemical compound with the molecular formula C8H8BNO2 and a molecular weight of 160.97 g/mol. IUPAC name: 1H-indol-7-ylboronic acid. InChIKey: HABOMNOJYJNVHE-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO2 |
|---|---|
| Molecular weight | 160.97 g/mol |
| IUPAC name | 1H-indol-7-ylboronic acid |
| InChIKey | HABOMNOJYJNVHE-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)C=CN2)(O)O |
Computed by PubChem (NCBI)