cas: 1417985-25-1 — see every product listed under this CAS number, including other names
(1H-Pyrazolo[3,4-b]pyridin-5-yl)boronic acid, 95%, 95% (CAS 1417985-25-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112H85-100mg |
| cas | 1417985-25-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 635.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1H-pyrazolo[5,4-b]pyridin-5-ylboronic acid (CAS 1417985-25-1) is a chemical compound with the molecular formula C6H6BN3O2 and a molecular weight of 162.94 g/mol. IUPAC name: 1H-pyrazolo[5,4-b]pyridin-5-ylboronic acid. InChIKey: JXIUBXRQKVVTPI-UHFFFAOYSA-N.
| Molecular formula | C6H6BN3O2 |
|---|---|
| Molecular weight | 162.94 g/mol |
| IUPAC name | 1H-pyrazolo[5,4-b]pyridin-5-ylboronic acid |
| InChIKey | JXIUBXRQKVVTPI-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(NN=C2)N=C1)(O)O |
Computed by PubChem (NCBI)