cas: 1417985-25-1 — see every product listed under this CAS number, including other names
(1H-Pyrazolo[3,4-b]pyridin-5-yl)boronic acid, 97% (CAS 1417985-25-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F545405-100MG |
| cas | 1417985-25-1 |
| size | 100mg |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 211.40 Pln | |
| Fluorochem | 250mg | 336.36 Pln | |
| Fluorochem | 1g | 851.80 Pln | |
| Fluorochem | 5g | 3954.88 Pln | |
| Fluorochem | 100mg | 211.40 Pln | |
| Fluorochem | 250mg | 336.36 Pln | |
| Fluorochem | 1g | 851.80 Pln | |
| Fluorochem | 5g | 3954.88 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
1H-pyrazolo[5,4-b]pyridin-5-ylboronic acid (CAS 1417985-25-1) is a chemical compound with the molecular formula C6H6BN3O2 and a molecular weight of 162.94 g/mol. IUPAC name: 1H-pyrazolo[5,4-b]pyridin-5-ylboronic acid. InChIKey: JXIUBXRQKVVTPI-UHFFFAOYSA-N.
| Molecular formula | C6H6BN3O2 |
|---|---|
| Molecular weight | 162.94 g/mol |
| IUPAC name | 1H-pyrazolo[5,4-b]pyridin-5-ylboronic acid |
| InChIKey | JXIUBXRQKVVTPI-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(NN=C2)N=C1)(O)O |
Computed by PubChem (NCBI)