cas: 26685-83-6 — see every product listed under this CAS number, including other names
(1R,2R)-2-Aminocyclohexane-1-carboxylic acid (CAS 26685-83-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F619191-100MG |
| cas | 26685-83-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 570.65 Pln | |
| Fluorochem | 10mg | 372.80 Pln | |
| Fluorochem | 250mg | 1060.06 Pln |
| delivery time | 3-4 weeks |
|---|
Trans-(1R,2R)-2-aminocyclohexane-1-carboxylic acid (CAS 26685-83-6) is a chemical compound with the molecular formula C7H13NO2 and a molecular weight of 143.18 g/mol. IUPAC name: trans-(1R,2R)-2-aminocyclohexane-1-carboxylic acid. InChIKey: USQHEVWOPJDAAX-PHDIDXHHSA-N.
| Molecular formula | C7H13NO2 |
|---|---|
| Molecular weight | 143.18 g/mol |
| IUPAC name | trans-(1R,2R)-2-aminocyclohexane-1-carboxylic acid |
| InChIKey | USQHEVWOPJDAAX-PHDIDXHHSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)C(=O)O)N |
Computed by PubChem (NCBI)