cas: 26685-83-6 — see every product listed under this CAS number, including other names
(1R,2R)-2-Aminocyclohexanecarboxylic acid, ≥98%, ≥98% (CAS 26685-83-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BGJ-100mg |
| cas | 26685-83-6 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 592.40 Pln | |
| Chemat | 10mg | 242.00 Pln | |
| Chemat | 250mg | 654.80 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
Trans-(1R,2R)-2-aminocyclohexane-1-carboxylic acid (CAS 26685-83-6) is a chemical compound with the molecular formula C7H13NO2 and a molecular weight of 143.18 g/mol. IUPAC name: trans-(1R,2R)-2-aminocyclohexane-1-carboxylic acid. InChIKey: USQHEVWOPJDAAX-PHDIDXHHSA-N.
| Molecular formula | C7H13NO2 |
|---|---|
| Molecular weight | 143.18 g/mol |
| IUPAC name | trans-(1R,2R)-2-aminocyclohexane-1-carboxylic acid |
| InChIKey | USQHEVWOPJDAAX-PHDIDXHHSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)C(=O)O)N |
Computed by PubChem (NCBI)