cas: 13374-31-7 — see every product listed under this CAS number, including other names
(1R,2R)-2-Aminocyclohexanol hydrochloride, 97%, 97% (CAS 13374-31-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HSZ0-250mg |
| cas | 13374-31-7 |
| size | 250mg |
| availability | 1500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 174.80 Pln | |
| Chemat | 25g | 338.00 Pln | |
| Chemat | 50g | 597.20 Pln | |
| Chemat | 100g | 1096.40 Pln | |
| Chemat | 500g | 5121.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Trans-(1R,2R)-2-aminocyclohexan-1-ol;hydrochloride (CAS 13374-31-7) is a chemical compound with the molecular formula C6H14ClNO and a molecular weight of 151.63 g/mol. IUPAC name: trans-(1R,2R)-2-aminocyclohexan-1-ol;hydrochloride. InChIKey: LKKCSUHCVGCGFA-KGZKBUQUSA-N.
| Molecular formula | C6H14ClNO |
|---|---|
| Molecular weight | 151.63 g/mol |
| IUPAC name | trans-(1R,2R)-2-aminocyclohexan-1-ol;hydrochloride |
| InChIKey | LKKCSUHCVGCGFA-KGZKBUQUSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)N)O.Cl |
Computed by PubChem (NCBI)