cas: 13374-31-7 — see every product listed under this CAS number, including other names
(1R,2R)-2-Aminocyclohexanol hydrochloride, 97% (CAS 13374-31-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F093763-5G |
| cas | 13374-31-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 138.51 Pln | |
| Fluorochem | 10g | 216.61 Pln | |
| Fluorochem | 25g | 445.69 Pln | |
| Fluorochem | 100g | 1611.95 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Trans-(1R,2R)-2-aminocyclohexan-1-ol;hydrochloride (CAS 13374-31-7) is a chemical compound with the molecular formula C6H14ClNO and a molecular weight of 151.63 g/mol. IUPAC name: trans-(1R,2R)-2-aminocyclohexan-1-ol;hydrochloride. InChIKey: LKKCSUHCVGCGFA-KGZKBUQUSA-N.
| Molecular formula | C6H14ClNO |
|---|---|
| Molecular weight | 151.63 g/mol |
| IUPAC name | trans-(1R,2R)-2-aminocyclohexan-1-ol;hydrochloride |
| InChIKey | LKKCSUHCVGCGFA-KGZKBUQUSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)N)O.Cl |
Computed by PubChem (NCBI)