CAS 221226-19-3 appears in our catalog under these names: (1R,2R)-N,N'-Bis(phenylmethyl)-1,2-diphenyl-1,2-ethanediamine, 97%, 97%, (1R,2R)-N,N'-Bis(phenylmethyl)-1,2-diphenyl-1,2-ethanediamine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(1R,2R)-N,N'-dibenzyl-1,2-diphenylethane-1,2-diamine (CAS 221226-19-3) is a chemical compound with the molecular formula C28H28N2 and a molecular weight of 392.5 g/mol. IUPAC name: (1R,2R)-N,N'-dibenzyl-1,2-diphenylethane-1,2-diamine. InChIKey: QEUWNGJNPLRKLR-VSGBNLITSA-N.
| Molecular formula | C28H28N2 |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | (1R,2R)-N,N'-dibenzyl-1,2-diphenylethane-1,2-diamine |
| InChIKey | QEUWNGJNPLRKLR-VSGBNLITSA-N |
| SMILES | C1=CC=C(C=C1)CN[C@H](C2=CC=CC=C2)[C@@H](C3=CC=CC=C3)NCC4=CC=CC=C4 |
Computed by PubChem (NCBI)