Products 3079360-43-0
CAS 3079360-43-0 is the registry number for N1-([1,1'-Biphenyl]-2-yl)-N1-(4-(tert-butyl)phenyl)benzene-1,4-diamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-N-(4-tert-butylphenyl)-4-N-(2-phenylphenyl)benzene-1,4-diamine (CAS 3079360-43-0) is a chemical compound with the molecular formula C28H28N2 and a molecular weight of 392.5 g/mol. IUPAC name: 4-N-(4-tert-butylphenyl)-4-N-(2-phenylphenyl)benzene-1,4-diamine. InChIKey: RWBOKAFDAOSCHM-UHFFFAOYSA-N.
| Molecular formula | C28H28N2 |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | 4-N-(4-tert-butylphenyl)-4-N-(2-phenylphenyl)benzene-1,4-diamine |
| InChIKey | RWBOKAFDAOSCHM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)N(C2=CC=C(C=C2)N)C3=CC=CC=C3C4=CC=CC=C4 |
Computed by PubChem (NCBI)