cas: 515-03-7 — see every product listed under this CAS number, including other names
(1R,2R,4aS,8aS)-1-((R)-3-Hydroxy-3-methylpent-4-en-1-yl)-2,5,5,8a-tetramethyldecahydronaphthalen-2-ol, 97% (CAS 515-03-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g, 1mg, 25mg. Offered by: BLDpharm, Chemat.
| brand | BLDpharm |
|---|---|
| catalog number | BD150930-100mg |
| cas | 515-03-7 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 100mg | 169.96 Pln | |
| BLDpharm | 250mg | 219.95 Pln | |
| BLDpharm | 1g | 414.32 Pln | |
| BLDpharm | 5g | 919.70 Pln | |
| BLDpharm | 25g | 2891.23 Pln | |
| BLDpharm | 100g | 9894.32 Pln | |
| Chemat | 1mg | 88.40 Pln | |
| Chemat | 25mg | 112.40 Pln | |
| Chemat | 50mg | 122.00 Pln | |
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 222.80 Pln | |
| Chemat | 5g | 722.00 Pln | |
| Chemat | 250g | 1528.40 Pln | |
| Chemat | 500g | 2337.60 Pln | |
| Chemat | 1kg | 3866.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Sclareol is a labdane diterpenoid that is labd-14-ene substituted by hydroxy groups at positions 8 and 13. It has been isolated from Salvia sclarea. It has a role as an antimicrobial agent, an antifungal agent, a fragrance, an apoptosis inducer and a plant metabolite.
Source: ChEBI
| Molecular formula | C20H36O2 |
|---|---|
| Molecular weight | 308.5 g/mol |
| IUPAC name | (1R,2R,4aS,8aS)-1-[(3R)-3-hydroxy-3-methylpent-4-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
| InChIKey | XVULBTBTFGYVRC-HHUCQEJWSA-N |
| SMILES | C[C@]12CCCC([C@@H]1CC[C@@]([C@@H]2CC[C@](C)(C=C)O)(C)O)(C)C |
Computed by PubChem (NCBI)