Products 1331665-14-5
CAS 1331665-14-5 is the registry number for Ethyl Linoleate-d5. Offered by: TRC. Available pack sizes: 250mg, 25mg.
1,1,2,2,2-pentadeuterioethyl (9Z,12Z)-octadeca-9,12-dienoate (CAS 1331665-14-5) is a chemical compound with the molecular formula C20H36O2 and a molecular weight of 313.5 g/mol. IUPAC name: 1,1,2,2,2-pentadeuterioethyl (9Z,12Z)-octadeca-9,12-dienoate. InChIKey: FMMOOAYVCKXGMF-ZISYHAQWSA-N.
| Molecular formula | C20H36O2 |
|---|---|
| Molecular weight | 313.5 g/mol |
| IUPAC name | 1,1,2,2,2-pentadeuterioethyl (9Z,12Z)-octadeca-9,12-dienoate |
| InChIKey | FMMOOAYVCKXGMF-ZISYHAQWSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC(=O)CCCCCCC/C=C\C/C=C\CCCCC |
Computed by PubChem (NCBI)
Synonyms:
Ethyl Linoleate-d5