cas: 310872-08-3 — see every product listed under this CAS number, including other names
(1R,2S)-1,2-Cyclopentanediamine, hydrochloride (1:2), 95%, 95% (CAS 310872-08-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114343-100mg |
| cas | 310872-08-3 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 448.40 Pln | |
| Chemat | 5g | 1427.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Cis-(1R,2S)-cyclopentane-1,2-diamine;dihydrochloride (CAS 310872-08-3) is a chemical compound with the molecular formula C5H14Cl2N2 and a molecular weight of 173.08 g/mol. IUPAC name: cis-(1R,2S)-cyclopentane-1,2-diamine;dihydrochloride. InChIKey: VZCLGIZICFQJBX-QGAATHCOSA-N.
| Molecular formula | C5H14Cl2N2 |
|---|---|
| Molecular weight | 173.08 g/mol |
| IUPAC name | cis-(1R,2S)-cyclopentane-1,2-diamine;dihydrochloride |
| InChIKey | VZCLGIZICFQJBX-QGAATHCOSA-N |
| SMILES | C1C[C@H]([C@H](C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)