cas: 310872-08-3 — see every product listed under this CAS number, including other names
cis-Cyclopentane-1,2-diamine dihydrochloride 95% (CAS 310872-08-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A433711-10g |
| cas | 310872-08-3 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 3379.69 Pln | |
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 670.75 Pln | |
| Ambeed | 5g | 2139.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A433711 |
Cis-(1R,2S)-cyclopentane-1,2-diamine;dihydrochloride (CAS 310872-08-3) is a chemical compound with the molecular formula C5H14Cl2N2 and a molecular weight of 173.08 g/mol. IUPAC name: cis-(1R,2S)-cyclopentane-1,2-diamine;dihydrochloride. InChIKey: VZCLGIZICFQJBX-QGAATHCOSA-N.
| Molecular formula | C5H14Cl2N2 |
|---|---|
| Molecular weight | 173.08 g/mol |
| IUPAC name | cis-(1R,2S)-cyclopentane-1,2-diamine;dihydrochloride |
| InChIKey | VZCLGIZICFQJBX-QGAATHCOSA-N |
| SMILES | C1C[C@H]([C@H](C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)