CAS 99363-25-4 appears in our catalog under these names: Trans-cyclopentane-1,2-diamine dihydrochloride, 95%, trans–Cyclopentane–1,2–diamine dihydrochloride, trans-Cyclopentane-1,2-diamine diHCl, trans-Cyclopentane-1,2-diamine dihydrochloride 98%, trans-Cyclopentane-1,2-diamine dihydrochloride, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 100mg, 5g, 1g.
Trans-(1R,2R)-cyclopentane-1,2-diamine;dihydrochloride (CAS 99363-25-4) is a chemical compound with the molecular formula C5H14Cl2N2 and a molecular weight of 173.08 g/mol. IUPAC name: trans-(1R,2R)-cyclopentane-1,2-diamine;dihydrochloride. InChIKey: VZCLGIZICFQJBX-ALUAXPQUSA-N.
| Molecular formula | C5H14Cl2N2 |
|---|---|
| Molecular weight | 173.08 g/mol |
| IUPAC name | trans-(1R,2R)-cyclopentane-1,2-diamine;dihydrochloride |
| InChIKey | VZCLGIZICFQJBX-ALUAXPQUSA-N |
| SMILES | C1C[C@H]([C@@H](C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)