cas: 88784-91-2 — see every product listed under this CAS number, including other names
(1R,2S)-1-Amino-1-phenylpropan-2-ol hydrochloride, 95%, 95% (CAS 88784-91-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IFGY-250mg |
| cas | 88784-91-2 |
| size | 250mg |
| availability | 0.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1514.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(1R,2S)-1-amino-1-phenylpropan-2-ol;hydrochloride (CAS 88784-91-2) is a chemical compound with the molecular formula C9H14ClNO and a molecular weight of 187.66 g/mol. IUPAC name: (1R,2S)-1-amino-1-phenylpropan-2-ol;hydrochloride. InChIKey: VIOJYFJDMKDXOT-KUSKTZOESA-N.
| Molecular formula | C9H14ClNO |
|---|---|
| Molecular weight | 187.66 g/mol |
| IUPAC name | (1R,2S)-1-amino-1-phenylpropan-2-ol;hydrochloride |
| InChIKey | VIOJYFJDMKDXOT-KUSKTZOESA-N |
| SMILES | C[C@@H]([C@@H](C1=CC=CC=C1)N)O.Cl |
Computed by PubChem (NCBI)