Products 1135288-77-5

CAS 1135288-77-5 is the registry number for 4-(1-Aminopropyl)phenol hydrochloride, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

4-(1-aminopropyl)phenol;hydrochloride (CAS 1135288-77-5) is a chemical compound with the molecular formula C9H14ClNO and a molecular weight of 187.66 g/mol. IUPAC name: 4-(1-aminopropyl)phenol;hydrochloride. InChIKey: RBZSZQKNTDZIHA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14ClNO
Molecular weight187.66 g/mol
IUPAC name4-(1-aminopropyl)phenol;hydrochloride
InChIKeyRBZSZQKNTDZIHA-UHFFFAOYSA-N
SMILESCCC(C1=CC=C(C=C1)O)N.Cl

Computed by PubChem (NCBI)