CAS 1304771-27-4 appears in our catalog under these names: (S)-1-(3-Methoxyphenyl)ethylamine hydrochloride, 95%, (S)-1-(3-Methoxyphenyl)ethanamine hydrochloride, 98%, (S)-1-(3-Methoxyphenyl)ethanamine hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg.
(1S)-1-(3-methoxyphenyl)ethanamine;hydrochloride (CAS 1304771-27-4) is a chemical compound with the molecular formula C9H14ClNO and a molecular weight of 187.66 g/mol. IUPAC name: (1S)-1-(3-methoxyphenyl)ethanamine;hydrochloride. InChIKey: IPMGDPJDHDVXRQ-FJXQXJEOSA-N.
| Molecular formula | C9H14ClNO |
|---|---|
| Molecular weight | 187.66 g/mol |
| IUPAC name | (1S)-1-(3-methoxyphenyl)ethanamine;hydrochloride |
| InChIKey | IPMGDPJDHDVXRQ-FJXQXJEOSA-N |
| SMILES | C[C@@H](C1=CC(=CC=C1)OC)N.Cl |
Computed by PubChem (NCBI)