cas: 136030-00-7 — see every product listed under this CAS number, including other names
(1R,2S)-1-Amino-2-indanol, 99.94% (CAS 136030-00-7) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 10 g, 500 g, 10mM/1mL, 250 g, 50 g, 5 g, 1000 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W007401-25 g |
| cas | 136030-00-7 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 500.81 Pln | |
| MedChemExpress | 10 g | 287.18 Pln | |
| MedChemExpress | 500 g | 5135.52 Pln | |
| MedChemExpress | 10mM/1mL | 250.03 Pln | |
| MedChemExpress | 250 g | 2952.84 Pln | |
| MedChemExpress | 50 g | 835.18 Pln | |
| MedChemExpress | 5 g | 240.74 Pln | |
| MedChemExpress | 1000 g | 8994.68 Pln | |
| MedChemExpress | 100 g | 1466.76 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.94% |
(1R,2S)-1-amino-2,3-dihydro-1H-inden-2-ol (CAS 136030-00-7) is a chemical compound with the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. IUPAC name: (1R,2S)-1-amino-2,3-dihydro-1H-inden-2-ol. InChIKey: LOPKSXMQWBYUOI-DTWKUNHWSA-N.
| Molecular formula | C9H11NO |
|---|---|
| Molecular weight | 149.19 g/mol |
| IUPAC name | (1R,2S)-1-amino-2,3-dihydro-1H-inden-2-ol |
| InChIKey | LOPKSXMQWBYUOI-DTWKUNHWSA-N |
| SMILES | C1[C@@H]([C@@H](C2=CC=CC=C21)N)O |
Computed by PubChem (NCBI)