cas: 136030-00-7 — see every product listed under this CAS number, including other names
(1R,2S)-1-amino-2,3-dihydro-1H-inden-2-ol, 98%, 98% (CAS 136030-00-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HUFM-1g |
| cas | 136030-00-7 |
| size | 1g |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 136.40 Pln | |
| Chemat | 25g | 237.20 Pln | |
| Chemat | 100g | 731.60 Pln | |
| Chemat | 500g | 3470.40 Pln | |
| Chemat | 1kg | 6856.40 Pln | |
| Chemat | 5kg | 23356.80 Pln | |
| Chemat | 10kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(1R,2S)-1-amino-2,3-dihydro-1H-inden-2-ol (CAS 136030-00-7) is a chemical compound with the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. IUPAC name: (1R,2S)-1-amino-2,3-dihydro-1H-inden-2-ol. InChIKey: LOPKSXMQWBYUOI-DTWKUNHWSA-N.
| Molecular formula | C9H11NO |
|---|---|
| Molecular weight | 149.19 g/mol |
| IUPAC name | (1R,2S)-1-amino-2,3-dihydro-1H-inden-2-ol |
| InChIKey | LOPKSXMQWBYUOI-DTWKUNHWSA-N |
| SMILES | C1[C@@H]([C@@H](C2=CC=CC=C21)N)O |
Computed by PubChem (NCBI)