cas: 1932394-12-1 — see every product listed under this CAS number, including other names
(1R,2S)-2-(difluoromethyl)cyclopropanecarboxylic acid, 97%, 97% (CAS 1932394-12-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12C5IX-100mg |
| cas | 1932394-12-1 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 3554.00 Pln | |
| Chemat | 250mg | 4720.40 Pln | |
| Chemat | 500mg | 7826.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Cis-(1R,2S)-2-(difluoromethyl)cyclopropane-1-carboxylic acid (CAS 1932394-12-1) is a chemical compound with the molecular formula C5H6F2O2 and a molecular weight of 136.10 g/mol. IUPAC name: cis-(1R,2S)-2-(difluoromethyl)cyclopropane-1-carboxylic acid. InChIKey: AQPYFAYLGMEWCD-STHAYSLISA-N.
| Molecular formula | C5H6F2O2 |
|---|---|
| Molecular weight | 136.10 g/mol |
| IUPAC name | cis-(1R,2S)-2-(difluoromethyl)cyclopropane-1-carboxylic acid |
| InChIKey | AQPYFAYLGMEWCD-STHAYSLISA-N |
| SMILES | C1[C@@H]([C@@H]1C(=O)O)C(F)F |
Computed by PubChem (NCBI)