CAS 883443-58-1 appears in our catalog under these names: Trans-2-(difluoromethyl)cyclopropanecarboxylic acid, 95%, rac-(1R,2R)-2-(Difluoromethyl)cyclopropane-1-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
Trans-(1R,2R)-2-(difluoromethyl)cyclopropane-1-carboxylic acid (CAS 883443-58-1) is a chemical compound with the molecular formula C5H6F2O2 and a molecular weight of 136.10 g/mol. IUPAC name: trans-(1R,2R)-2-(difluoromethyl)cyclopropane-1-carboxylic acid. InChIKey: AQPYFAYLGMEWCD-PWNYCUMCSA-N.
| Molecular formula | C5H6F2O2 |
|---|---|
| Molecular weight | 136.10 g/mol |
| IUPAC name | trans-(1R,2R)-2-(difluoromethyl)cyclopropane-1-carboxylic acid |
| InChIKey | AQPYFAYLGMEWCD-PWNYCUMCSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C(F)F |
Computed by PubChem (NCBI)