CAS 1932394-12-1 appears in our catalog under these names: rac-(1r,2s)-2-(difluoromethyl)cyclopropane-1-carboxylic acid, 95%, (1R,2S)-2-(Difluoromethyl)cyclopropane-1-carboxylic acid, 98%, (1R,2S)-2-(difluoromethyl)cyclopropanecarboxylic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg.
Cis-(1R,2S)-2-(difluoromethyl)cyclopropane-1-carboxylic acid (CAS 1932394-12-1) is a chemical compound with the molecular formula C5H6F2O2 and a molecular weight of 136.10 g/mol. IUPAC name: cis-(1R,2S)-2-(difluoromethyl)cyclopropane-1-carboxylic acid. InChIKey: AQPYFAYLGMEWCD-STHAYSLISA-N.
| Molecular formula | C5H6F2O2 |
|---|---|
| Molecular weight | 136.10 g/mol |
| IUPAC name | cis-(1R,2S)-2-(difluoromethyl)cyclopropane-1-carboxylic acid |
| InChIKey | AQPYFAYLGMEWCD-STHAYSLISA-N |
| SMILES | C1[C@@H]([C@@H]1C(=O)O)C(F)F |
Computed by PubChem (NCBI)