cas: 143062-84-4 — see every product listed under this CAS number, including other names
(1R,2S)-2-Fluorocyclopropanamine 4-methylbenzenesulfonate 97% (CAS 143062-84-4) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A105983-500g |
| cas | 143062-84-4 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 14126.44 Pln | |
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 10g | 481.62 Pln | |
| Ambeed | 25g | 1032.31 Pln | |
| Ambeed | 100g | 3585.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A105983 |
Cis-(1R,2S)-2-fluorocyclopropan-1-amine;4-methylbenzenesulfonic acid (CAS 143062-84-4) is a chemical compound with the molecular formula C10H14FNO3S and a molecular weight of 247.29 g/mol. IUPAC name: cis-(1R,2S)-2-fluorocyclopropan-1-amine;4-methylbenzenesulfonic acid. InChIKey: XUWZMHVPMZXIRU-LMLSDSMGSA-N.
| Molecular formula | C10H14FNO3S |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | cis-(1R,2S)-2-fluorocyclopropan-1-amine;4-methylbenzenesulfonic acid |
| InChIKey | XUWZMHVPMZXIRU-LMLSDSMGSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1[C@H]([C@H]1F)N |
Computed by PubChem (NCBI)