(1R，2S)-2-Fluorocyclopropanamine 4-methylbenzenesulfonate, 98%, 98%
cas: 143062-84-4 — see every product listed under this CAS number, including other names
(1R，2S)-2-Fluorocyclopropanamine 4-methylbenzenesulfonate, 98%, 98% (CAS 143062-84-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148S7-50mg |
| cas | 143062-84-4 |
| size | 50mg |
| availability | 1000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 78.80 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 10g | 280.40 Pln | |
| Chemat | 25g | 525.20 Pln | |
| Chemat | 50g | 971.60 Pln | |
| Chemat | 100g | 1854.80 Pln | |
| Chemat | 250g | 3746.00 Pln | |
| Chemat | 500g | 6028.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Cis-(1R,2S)-2-fluorocyclopropan-1-amine;4-methylbenzenesulfonic acid (CAS 143062-84-4) is a chemical compound with the molecular formula C10H14FNO3S and a molecular weight of 247.29 g/mol. IUPAC name: cis-(1R,2S)-2-fluorocyclopropan-1-amine;4-methylbenzenesulfonic acid. InChIKey: XUWZMHVPMZXIRU-LMLSDSMGSA-N.
| Molecular formula | C10H14FNO3S |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | cis-(1R,2S)-2-fluorocyclopropan-1-amine;4-methylbenzenesulfonic acid |
| InChIKey | XUWZMHVPMZXIRU-LMLSDSMGSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1[C@H]([C@H]1F)N |
Computed by PubChem (NCBI)
Synonyms:
(1R,2S)-2-fluorocyclopropan-1-amine;4-methylbenzenesulfonic acid, (1R,2S)-2-Fluorocyclopropanamine 4-methylbenzenesulfonate, (1R,2S)-2-Fluorocyclopropylamine tosylate, (1R,2S)-2-fluorocyclopropan-1-amine; 4-methylbenzene-1-sulfonic acid, cis-2-Fluorocyclopropanamine 4-methylbenzenesulfonate, (1R,2S)-2-Fluorocyclopropan-1-amine 4-methylbenzenesulfonate, (1r,2s)-2-fluorocyclopropylamine p-toluenesulfonic acid salt, Cyclopropanamine, 2-fluoro-, cis-, 4-methylbenzenesulfonate, (1r,2s)-2-fluorocyclop, (cis)-2-fluorocyclopropanamine 4-methylbenzenesulfonate