CAS 143062-84-4 appears in our catalog under these names: (1R,2S)-2-Fluorocyclopropanamine 4-methylbenzenesulfonate, 97%, (1R,2S)-2-Fluorocyclopropanamine 4-methylbenzenesulfonate, 95%, (1R,2S)-2-Fluorocyclopropanamine 4-methylbenzenesulfonate, 98%, 98%, Sitafloxacin Impurity 9 Tosylate. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat, Chemat Brand. Available pack sizes: 1g, 25g, 5g, 10g, 100g, 250mg, 500g, 50mg.
Cis-(1R,2S)-2-fluorocyclopropan-1-amine;4-methylbenzenesulfonic acid (CAS 143062-84-4) is a chemical compound with the molecular formula C10H14FNO3S and a molecular weight of 247.29 g/mol. IUPAC name: cis-(1R,2S)-2-fluorocyclopropan-1-amine;4-methylbenzenesulfonic acid. InChIKey: XUWZMHVPMZXIRU-LMLSDSMGSA-N.
| Molecular formula | C10H14FNO3S |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | cis-(1R,2S)-2-fluorocyclopropan-1-amine;4-methylbenzenesulfonic acid |
| InChIKey | XUWZMHVPMZXIRU-LMLSDSMGSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1[C@H]([C@H]1F)N |
Computed by PubChem (NCBI)