cas: 10027-80-2 — see every product listed under this CAS number, including other names
(1R,2S)-Cyclohexane-1,2-diamine dihydrochloride, 95%, 95% (CAS 10027-80-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1112FP-100mg |
| cas | 10027-80-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 1g | 611.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Cis-(1R,2S)-cyclohexane-1,2-diamine;dihydrochloride (CAS 10027-80-2) is a chemical compound with the molecular formula C6H16Cl2N2 and a molecular weight of 187.11 g/mol. IUPAC name: cis-(1R,2S)-cyclohexane-1,2-diamine;dihydrochloride. InChIKey: HEKOZXSZLOBKGM-RUTFAPCESA-N.
| Molecular formula | C6H16Cl2N2 |
|---|---|
| Molecular weight | 187.11 g/mol |
| IUPAC name | cis-(1R,2S)-cyclohexane-1,2-diamine;dihydrochloride |
| InChIKey | HEKOZXSZLOBKGM-RUTFAPCESA-N |
| SMILES | C1CC[C@@H]([C@@H](C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)