CAS 10027-80-2 appears in our catalog under these names: (1R,2S)-Cyclohexane-1,2-diamine dihydrochloride, 95%, (1R,2S)–cyclohexane–1,2–diamine dihydrochloride, (1R,2S)-Cyclohexane-1,2-diamine dihydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
Cis-(1R,2S)-cyclohexane-1,2-diamine;dihydrochloride (CAS 10027-80-2) is a chemical compound with the molecular formula C6H16Cl2N2 and a molecular weight of 187.11 g/mol. IUPAC name: cis-(1R,2S)-cyclohexane-1,2-diamine;dihydrochloride. InChIKey: HEKOZXSZLOBKGM-RUTFAPCESA-N.
| Molecular formula | C6H16Cl2N2 |
|---|---|
| Molecular weight | 187.11 g/mol |
| IUPAC name | cis-(1R,2S)-cyclohexane-1,2-diamine;dihydrochloride |
| InChIKey | HEKOZXSZLOBKGM-RUTFAPCESA-N |
| SMILES | C1CC[C@@H]([C@@H](C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)