CAS 35018-62-3 is the registry number for (1S,2S)-Cyclohexane-1,2-diamine dihydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1S,2S)-cyclohexane-1,2-diamine;dihydrochloride (CAS 35018-62-3) is a chemical compound with the molecular formula C6H16Cl2N2 and a molecular weight of 187.11 g/mol. IUPAC name: trans-(1S,2S)-cyclohexane-1,2-diamine;dihydrochloride. InChIKey: HEKOZXSZLOBKGM-USPAICOZSA-N.
| Molecular formula | C6H16Cl2N2 |
|---|---|
| Molecular weight | 187.11 g/mol |
| IUPAC name | trans-(1S,2S)-cyclohexane-1,2-diamine;dihydrochloride |
| InChIKey | HEKOZXSZLOBKGM-USPAICOZSA-N |
| SMILES | C1CC[C@@H]([C@H](C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)