(1R,3R)-3-{[(tert-Butoxy)carbonyl]amino}cyclohexane-1-carboxylic acid, 95%
cas: 1430938-32-1 — see every product listed under this CAS number, including other names
(1R,3R)-3-{[(tert-Butoxy)carbonyl]amino}cyclohexane-1-carboxylic acid, 95% (CAS 1430938-32-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A710268-250mg |
| cas | 1430938-32-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1154.69 Pln | |
| Ambeed | 1g | 2228.25 Pln | |
| Chemat | 100mg | 534.80 Pln | |
| Chemat | 250mg | 573.20 Pln | |
| Chemat | 500mg | 995.60 Pln | |
| Chemat | 1g | 1456.40 Pln | |
| Chemat | 5g | 5963.60 Pln | |
| Chemat | 10g | 11373.20 Pln | |
| BLDpharm | 100mg | 758.65 Pln | |
| BLDpharm | 250mg | 1230.70 Pln | |
| BLDpharm | 1g | 2385.85 Pln | |
| BLDpharm | 5g | 7023.11 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Trans-(1R,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid (CAS 1430938-32-1) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: trans-(1R,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid. InChIKey: JSGHMGKJNZTKGF-RKDXNWHRSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | trans-(1R,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid |
| InChIKey | JSGHMGKJNZTKGF-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@H](C1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(1R,3R)-3-{[(tert-butoxy)carbonyl]amino}cyclohexane-1-carboxylic acid, (1R,3R)-3-([(tert-Butoxy)carbonyl]amino)cyclohexane-1-carboxylic acid, rac-(1R,3R)-3-{[(tert-butoxy)carbonyl]amino}cyclohexane-1-carboxylic acid, (1R,3R)-3-(((tert-butoxy)carbonyl)amino)cyclohexane-1-carboxylic acid, rac-(1R,3R)-3-(((tert-butoxy)carbonyl)amino)cyclohexane-1-carboxylic acid, Trans-3-tert-butoxycarbonylaminocyclohexanecarboxylic acid, (1R,3R)-3-(tert-butoxycarbonylamino)cyclohexanecarboxylic acid, (1R,3R)-3-((tert-butoxycarbonyl)amino)cyclohexane-1-carboxylic acid, (Cyclohexanecarboxylic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-, (1R,3R)), trans-3-((tert-Butoxycarbonyl)amino)cyclohexanecarboxylic acid