CAS 1414958-09-0 appears in our catalog under these names: trans-1-(tert-butoxycarbonyl)-3-methyl-4-piperidinecarboxylic acid, 95%, trans-1-(tert-Butoxycarbonyl)-3-methylpiperidine-4-carboxylic acid 98%, trans-1-N-Boc-3-methylpiperidine-4-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 50mg, 100mg, 5g.
(3R,4S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid (CAS 1414958-09-0) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (3R,4S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid. InChIKey: ZFQQTPBWJCJGSV-IUCAKERBSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (3R,4S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
| InChIKey | ZFQQTPBWJCJGSV-IUCAKERBSA-N |
| SMILES | C[C@H]1CN(CC[C@@H]1C(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)