CAS 1932492-10-8 is the registry number for (2R,4R)-tert-Butyl 4-hydroxy-2-propionylpyrrolidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl (2R,4R)-4-hydroxy-2-propanoylpyrrolidine-1-carboxylate (CAS 1932492-10-8) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: tert-butyl (2R,4R)-4-hydroxy-2-propanoylpyrrolidine-1-carboxylate. InChIKey: NVUGNNQATMLQPB-RKDXNWHRSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | tert-butyl (2R,4R)-4-hydroxy-2-propanoylpyrrolidine-1-carboxylate |
| InChIKey | NVUGNNQATMLQPB-RKDXNWHRSA-N |
| SMILES | CCC(=O)[C@H]1C[C@H](CN1C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)