cas: 21531-44-2 — see every product listed under this CAS number, including other names
(1R,3S)-3-Hydroxycyclohexanecarboxylic acid 97% (CAS 21531-44-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A428588-100mg |
| cas | 21531-44-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 542.81 Pln | |
| Ambeed | 250mg | 765.31 Pln | |
| Ambeed | 1g | 1811.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A428588 |
Cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid (CAS 21531-44-2) is a chemical compound with the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. IUPAC name: cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid. InChIKey: JBZDHFKPEDWWJC-RITPCOANSA-N.
| Molecular formula | C7H12O3 |
|---|---|
| Molecular weight | 144.17 g/mol |
| IUPAC name | cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid |
| InChIKey | JBZDHFKPEDWWJC-RITPCOANSA-N |
| SMILES | C1C[C@H](C[C@H](C1)O)C(=O)O |
Computed by PubChem (NCBI)