Products 21531-44-2
CAS 21531-44-2 appears in our catalog under these names: (1R,3S)-3-Hydroxycyclohexane-1-carboxylic acid, 95%, (1R,3S)-3-Hydroxycyclohexanecarboxylic acid, 97%, (1R,3S)-3-Hydroxycyclohexanecarboxylic acid 97%, (1R,3S)-3-Hydroxycyclohexanecarboxylic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 10g, 1g, 25g, 5g, 100mg, 250mg.
Cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid (CAS 21531-44-2) is a chemical compound with the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. IUPAC name: cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid. InChIKey: JBZDHFKPEDWWJC-RITPCOANSA-N.
| Molecular formula | C7H12O3 |
|---|---|
| Molecular weight | 144.17 g/mol |
| IUPAC name | cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid |
| InChIKey | JBZDHFKPEDWWJC-RITPCOANSA-N |
| SMILES | C1C[C@H](C[C@H](C1)O)C(=O)O |
Computed by PubChem (NCBI)