CAS 23369-01-9 is the registry number for Trans-3-hydroxycyclohexanecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
Trans-(1S,3S)-3-hydroxycyclohexane-1-carboxylic acid (CAS 23369-01-9) is a chemical compound with the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. IUPAC name: trans-(1S,3S)-3-hydroxycyclohexane-1-carboxylic acid. InChIKey: JBZDHFKPEDWWJC-WDSKDSINSA-N.
| Molecular formula | C7H12O3 |
|---|---|
| Molecular weight | 144.17 g/mol |
| IUPAC name | trans-(1S,3S)-3-hydroxycyclohexane-1-carboxylic acid |
| InChIKey | JBZDHFKPEDWWJC-WDSKDSINSA-N |
| SMILES | C1C[C@@H](C[C@H](C1)O)C(=O)O |
Computed by PubChem (NCBI)