cas: 54664-61-8 — see every product listed under this CAS number, including other names
(1R,3S)-rel-Cyclopent-4-ene-1,3-diyl diacetate 98% (CAS 54664-61-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A352213-100mg |
| cas | 54664-61-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 192.38 Pln | |
| Ambeed | 5g | 581.75 Pln | |
| Ambeed | 25g | 2545.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A352213 |
[(1S,4R)-4-acetyloxycyclopent-2-en-1-yl] acetate (CAS 54664-61-8) is a chemical compound with the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. IUPAC name: [(1S,4R)-4-acetyloxycyclopent-2-en-1-yl] acetate. InChIKey: UKPIBFMHHUEUQR-DTORHVGOSA-N.
| Molecular formula | C9H12O4 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | [(1S,4R)-4-acetyloxycyclopent-2-en-1-yl] acetate |
| InChIKey | UKPIBFMHHUEUQR-DTORHVGOSA-N |
| SMILES | CC(=O)O[C@@H]1C[C@@H](C=C1)OC(=O)C |
Computed by PubChem (NCBI)