CAS 63177-18-4 appears in our catalog under these names: 2-(Carboxymethyl)-1-cyclohexene-1-carboxylic acid, 95%, 2–(Carboxymethyl)–1–cyclohexene–1–carboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2-(carboxymethyl)cyclohexene-1-carboxylic acid (CAS 63177-18-4) is a chemical compound with the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. IUPAC name: 2-(carboxymethyl)cyclohexene-1-carboxylic acid. InChIKey: PVUSUYXIVGSQHU-UHFFFAOYSA-N.
| Molecular formula | C9H12O4 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 2-(carboxymethyl)cyclohexene-1-carboxylic acid |
| InChIKey | PVUSUYXIVGSQHU-UHFFFAOYSA-N |
| SMILES | C1CCC(=C(C1)CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)