Products 1881320-81-5
CAS 1881320-81-5 is the registry number for tert-butyl 5-hydroxyfuran-2-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Tert-butyl 5-hydroxyfuran-2-carboxylate (CAS 1881320-81-5) is a chemical compound with the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. IUPAC name: tert-butyl 5-hydroxyfuran-2-carboxylate. InChIKey: JZMYTUHNZIVMLN-UHFFFAOYSA-N.
| Molecular formula | C9H12O4 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | tert-butyl 5-hydroxyfuran-2-carboxylate |
| InChIKey | JZMYTUHNZIVMLN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=C(O1)O |
Computed by PubChem (NCBI)