cas: 1392745-66-2 — see every product listed under this CAS number, including other names
(1R,3S,4S)-4-(Boc-amino)-3-hydroxy-cyclohexanecarboxylic acid ethyl ester, 97%, 97% (CAS 1392745-66-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112AMJ-100mg |
| cas | 1392745-66-2 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 616.40 Pln | |
| Chemat | 250mg | 995.60 Pln | |
| Chemat | 500mg | 1902.80 Pln | |
| Chemat | 1g | 2805.20 Pln | |
| Chemat | 5g | 8286.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl (1R,3S,4S)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate (CAS 1392745-66-2) is a chemical compound with the molecular formula C14H25NO5 and a molecular weight of 287.35 g/mol. IUPAC name: ethyl (1R,3S,4S)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate. InChIKey: JOOLXBLTNBWCNP-VWYCJHECSA-N.
| Molecular formula | C14H25NO5 |
|---|---|
| Molecular weight | 287.35 g/mol |
| IUPAC name | ethyl (1R,3S,4S)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate |
| InChIKey | JOOLXBLTNBWCNP-VWYCJHECSA-N |
| SMILES | CCOC(=O)[C@@H]1CC[C@@H]([C@H](C1)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)