CAS 170850-75-6 appears in our catalog under these names: Boc-hyp-otbu, 98%, Boc–Hyp–OtBu, Boc-L-trans-4-hydroxyproline tert-butyl ester, Boc-Hyp-OtBu 97%, (2S,4R)-Di-tert-Butyl 4-hydroxypyrrolidine-1,2-dicarboxylate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 25g.
Ditert-butyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate (CAS 170850-75-6) is a chemical compound with the molecular formula C14H25NO5 and a molecular weight of 287.35 g/mol. IUPAC name: ditert-butyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate. InChIKey: OXHIVNUWGSCHBD-ZJUUUORDSA-N.
| Molecular formula | C14H25NO5 |
|---|---|
| Molecular weight | 287.35 g/mol |
| IUPAC name | ditert-butyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate |
| InChIKey | OXHIVNUWGSCHBD-ZJUUUORDSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@H](CN1C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)