CAS 145625-08-7 appears in our catalog under these names: (2R,4S)-3-tert-Butyl 4-methyl 2-tert-butyloxazolidine-3,4-dicarboxylate, 95%, (2R,4S)–3–tert–Butyl 4–methyl 2–(tert–butyl)oxazolidine–3,4–dicarboxylate, 3-(1,1-Dimethylethyl) 4-methyl (2R,4S)-2-(1,1-dimethylethyl)-3,4-oxazolidinedicarboxylate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
3-O-tert-butyl 4-O-methyl (2R,4S)-2-tert-butyl-1,3-oxazolidine-3,4-dicarboxylate (CAS 145625-08-7) is a chemical compound with the molecular formula C14H25NO5 and a molecular weight of 287.35 g/mol. IUPAC name: 3-O-tert-butyl 4-O-methyl (2R,4S)-2-tert-butyl-1,3-oxazolidine-3,4-dicarboxylate. InChIKey: GZAZHWGEIRAXKK-GXSJLCMTSA-N.
| Molecular formula | C14H25NO5 |
|---|---|
| Molecular weight | 287.35 g/mol |
| IUPAC name | 3-O-tert-butyl 4-O-methyl (2R,4S)-2-tert-butyl-1,3-oxazolidine-3,4-dicarboxylate |
| InChIKey | GZAZHWGEIRAXKK-GXSJLCMTSA-N |
| SMILES | CC(C)(C)[C@@H]1N([C@@H](CO1)C(=O)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)