cas: 615575-74-1 — see every product listed under this CAS number, including other names
(1R,4S,5S)-2-(tert-Butoxycarbonyl)-2-azabicyclo[2.1.1]hexane-5-carboxylic acid, 97%, 97% (CAS 615575-74-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11F06G-50mg |
| cas | 615575-74-1 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 338.00 Pln | |
| Chemat | 100mg | 390.80 Pln | |
| Chemat | 250mg | 592.40 Pln | |
| Chemat | 1g | 2176.40 Pln | |
| Chemat | 5g | 8416.40 Pln | |
| Chemat | 10g | 15846.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(1R,4S,5S)-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azabicyclo[2.1.1]hexane-5-carboxylic acid (CAS 615575-74-1) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: (1R,4S,5S)-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azabicyclo[2.1.1]hexane-5-carboxylic acid. InChIKey: VGONMHFNYUTBCO-PRJMDXOYSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | (1R,4S,5S)-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azabicyclo[2.1.1]hexane-5-carboxylic acid |
| InChIKey | VGONMHFNYUTBCO-PRJMDXOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@@H]1[C@H]2C(=O)O |
Computed by PubChem (NCBI)