CAS 1256914-30-3 is the registry number for (1S,4R,5R)-2-((tert-butoxy)carbonyl)-2-azabicyclo(2.1.1)hexane-5-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 100mg, 1g, 250mg.
(1S,4R,5R)-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azabicyclo[2.1.1]hexane-5-carboxylic acid (CAS 1256914-30-3) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: (1S,4R,5R)-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azabicyclo[2.1.1]hexane-5-carboxylic acid. InChIKey: VGONMHFNYUTBCO-BIIVOSGPSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | (1S,4R,5R)-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azabicyclo[2.1.1]hexane-5-carboxylic acid |
| InChIKey | VGONMHFNYUTBCO-BIIVOSGPSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2C[C@H]1[C@@H]2C(=O)O |
Computed by PubChem (NCBI)