CAS 1822326-55-5 appears in our catalog under these names: (1S)-2-Methyl-1-phenylbutan-1-amine hydrochloride, 95%, (1S)-2-Methyl-1-phenylbutan-1-amine hydrochloride, 95+%, (1S)-2-Methyl-1-phenylbutan-1-amine hydrochloride, 95+%, 95+%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
(1S)-2-methyl-1-phenylbutan-1-amine;hydrochloride (CAS 1822326-55-5) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: (1S)-2-methyl-1-phenylbutan-1-amine;hydrochloride. InChIKey: OBSSYONPWUBLOS-VLTGDTDDSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | (1S)-2-methyl-1-phenylbutan-1-amine;hydrochloride |
| InChIKey | OBSSYONPWUBLOS-VLTGDTDDSA-N |
| SMILES | CCC(C)[C@@H](C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)