CAS 19068-35-0 appears in our catalog under these names: (R)-2,2-Dimethyl-1-phenylpropan-1-amine hydrochloride, 95%, (R)–2,2–Dimethyl–1–phenylpropan–1–amine hydrochloride, (R)-2,2-Dimethyl-1-phenylpropan-1-amine hydrochloride, (R)-2,2-Dimethyl-1-phenylpropan-1-amine hydrochloride, 97%, 97%, (R)-2,2-Dimethyl-1-phenylpropan-1-amine hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 5g, 1g, 0,25g.
(1R)-2,2-dimethyl-1-phenylpropan-1-amine;hydrochloride (CAS 19068-35-0) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: (1R)-2,2-dimethyl-1-phenylpropan-1-amine;hydrochloride. InChIKey: BMOFDSTXFQCVDC-PPHPATTJSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | (1R)-2,2-dimethyl-1-phenylpropan-1-amine;hydrochloride |
| InChIKey | BMOFDSTXFQCVDC-PPHPATTJSA-N |
| SMILES | CC(C)(C)[C@H](C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)